CAS 1346599-58-3 is the registry number for 1-Iodohexane-d13. Offered by: TRC. Available pack sizes: 5mg.
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecadeuterio-6-iodohexane (CAS 1346599-58-3) is a chemical compound with the molecular formula C6H13I and a molecular weight of 225.15 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecadeuterio-6-iodohexane. InChIKey: ANOOTOPTCJRUPK-UTBWLCBWSA-N.
| Molecular formula | C6H13I |
|---|---|
| Molecular weight | 225.15 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecadeuterio-6-iodohexane |
| InChIKey | ANOOTOPTCJRUPK-UTBWLCBWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])I |
Computed by PubChem (NCBI)