CAS 1346599-59-4 appears in our catalog under these names: (Rac)-2-Aminothiazoline-4-carboxylic acid-13C,15N2, rac 2-Aminothiazoline-4-carboxylic Acid-13C,15N2, >95% (HPLC). Offered by: MedChemExpress, TRC. Available pack sizes: 1 mg, 10mg, 1mg.
2-(15N)azanyl-(213C,315N)4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS 1346599-59-4) is a chemical compound with the molecular formula C4H6N2O2S and a molecular weight of 149.15 g/mol. IUPAC name: 2-(15N)azanyl-(213C,315N)4,5-dihydro-1,3-thiazole-4-carboxylic acid. InChIKey: VHPXSBIFWDAFMB-VMGGCIAMSA-N.
| Molecular formula | C4H6N2O2S |
|---|---|
| Molecular weight | 149.15 g/mol |
| IUPAC name | 2-(15N)azanyl-(213C,315N)4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| InChIKey | VHPXSBIFWDAFMB-VMGGCIAMSA-N |
| SMILES | C1C([15N]=[13C](S1)[15NH2])C(=O)O |
Computed by PubChem (NCBI)