CAS 1346599-62-9 appears in our catalog under these names: Ternidazole-d6 Hydrochloride (>90%), Ternidazole-d6 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
1,1,2,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol;hydrochloride (CAS 1346599-62-9) is a chemical compound with the molecular formula C7H12ClN3O3 and a molecular weight of 227.68 g/mol. IUPAC name: 1,1,2,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol;hydrochloride. InChIKey: PTXLKVODAFRGDG-RYKMJATISA-N.
| Molecular formula | C7H12ClN3O3 |
|---|---|
| Molecular weight | 227.68 g/mol |
| IUPAC name | 1,1,2,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol;hydrochloride |
| InChIKey | PTXLKVODAFRGDG-RYKMJATISA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])N1C(=NC=C1[N+](=O)[O-])C)C([2H])([2H])O.Cl |
Computed by PubChem (NCBI)