Products 1346599-65-2
CAS 1346599-65-2 appears in our catalog under these names: Phentolamine-d4 HCl (Regitine-d4 HCl), Phentolamine-d4 Hydrochloride, >95% (HPLC), Phentolamine–d4 (hydrochloride), Phentolamine-d4 hydrochloride, Phentolamine-d4 (hydrochloride). Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
3-[4-methyl-N-[(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)methyl]anilino]phenol;hydrochloride (CAS 1346599-65-2) is a chemical compound with the molecular formula C17H20ClN3O and a molecular weight of 321.8 g/mol. IUPAC name: 3-[4-methyl-N-[(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)methyl]anilino]phenol;hydrochloride. InChIKey: TUEJFGFQYKDAPM-PQDNHERISA-N.
| Molecular formula | C17H20ClN3O |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | 3-[4-methyl-N-[(4,4,5,5-tetradeuterio-1H-imidazol-2-yl)methyl]anilino]phenol;hydrochloride |
| InChIKey | TUEJFGFQYKDAPM-PQDNHERISA-N |
| SMILES | [2H]C1(C(N=C(N1)CN(C2=CC=C(C=C2)C)C3=CC(=CC=C3)O)([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)