CAS 1346599-72-1 appears in our catalog under these names: Clotiazepam-13C,d3 (1mg/ml in Acetonitrile), Clotiazepam-13C,d3. Offered by: TRC. Available pack sizes: 1x1ml, 10mg, 1mg.
5-(2-chlorophenyl)-7-ethyl-1-(trideuterio(113C)methyl)-3H-thieno[2,3-e][1,4]diazepin-2-one (CAS 1346599-72-1) is a chemical compound with the molecular formula C16H15ClN2OS and a molecular weight of 322.8 g/mol. IUPAC name: 5-(2-chlorophenyl)-7-ethyl-1-(trideuterio(113C)methyl)-3H-thieno[2,3-e][1,4]diazepin-2-one. InChIKey: CHBRHODLKOZEPZ-JVXUGDAPSA-N.
| Molecular formula | C16H15ClN2OS |
|---|---|
| Molecular weight | 322.8 g/mol |
| IUPAC name | 5-(2-chlorophenyl)-7-ethyl-1-(trideuterio(113C)methyl)-3H-thieno[2,3-e][1,4]diazepin-2-one |
| InChIKey | CHBRHODLKOZEPZ-JVXUGDAPSA-N |
| SMILES | [2H][13C]([2H])([2H])N1C(=O)CN=C(C2=C1SC(=C2)CC)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)