Products 1346599-76-5
CAS 1346599-76-5 appears in our catalog under these names: Adapalene EP Impurity B, Adapalene Impurity 2（Adapalene EP Impurity B）, Hydroxy Adapalene, >95% (HPLC), Hydroxy Adapalene, 6-[3-(3-Hydroxytricyclo[3.3.1.13,7]dec-1-yl)-4-methoxyphenyl]-2-naphthalenecarboxylic acid, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 5mg.
6-[3-(3-hydroxy-1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylic acid (CAS 1346599-76-5) is a chemical compound with the molecular formula C28H28O4 and a molecular weight of 428.5 g/mol. IUPAC name: 6-[3-(3-hydroxy-1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylic acid. InChIKey: ZVFMDETWRVTMJF-UHFFFAOYSA-N.
| Molecular formula | C28H28O4 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 6-[3-(3-hydroxy-1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylic acid |
| InChIKey | ZVFMDETWRVTMJF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC3=C(C=C2)C=C(C=C3)C(=O)O)C45CC6CC(C4)CC(C6)(C5)O |
Computed by PubChem (NCBI)
Synonyms:
Hydroxy Adapalene, Adapalene EP Impurity B, 6-[3-(3-hydroxy-1-adamantyl)-4-methoxyphenyl]naphthalene-2-carboxylic acid, 6-(3-(3-hydroxyadamantan-1-yl)-4-methoxyphenyl)-2-naphthoic acid, Adapalene impurity B [EP], HYDROXYADAPALENE, HYDROXYADAPALENE [USP IMPURITY], ADAPALENE IMPURITY B [EP IMPURITY], 6-[3-(3-hydroxy-1-adamantyl)-4-methoxy-phenyl]naphthalene-2-carboxylic acid