CAS 1346599-87-8 is the registry number for 1-(Methyl-d3)-2-imidazolidinone. Offered by: TRC. Available pack sizes: 25mg.
1-(trideuteriomethyl)imidazolidin-2-one (CAS 1346599-87-8) is a chemical compound with the molecular formula C4H8N2O and a molecular weight of 103.14 g/mol. IUPAC name: 1-(trideuteriomethyl)imidazolidin-2-one. InChIKey: JTPZTKBRUCILQD-FIBGUPNXSA-N.
| Molecular formula | C4H8N2O |
|---|---|
| Molecular weight | 103.14 g/mol |
| IUPAC name | 1-(trideuteriomethyl)imidazolidin-2-one |
| InChIKey | JTPZTKBRUCILQD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCNC1=O |
Computed by PubChem (NCBI)