CAS 13466-20-1 appears in our catalog under these names: Barium dihydrogen phosphate 99% +(BaO/%≥45%), Barium dihydrogen phosphate, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 25g, 100g, 500g.
Barium(2+);bis(dihydrogen phosphate) (CAS 13466-20-1) is a chemical compound with the molecular formula BaH4O8P2 and a molecular weight of 331.30 g/mol. IUPAC name: barium(2+);bis(dihydrogen phosphate). InChIKey: IOPOLWHQYJSKCT-UHFFFAOYSA-L.
| Molecular formula | BaH4O8P2 |
|---|---|
| Molecular weight | 331.30 g/mol |
| IUPAC name | barium(2+);bis(dihydrogen phosphate) |
| InChIKey | IOPOLWHQYJSKCT-UHFFFAOYSA-L |
| SMILES | OP(=O)(O)[O-].OP(=O)(O)[O-].[Ba+2] |
Computed by PubChem (NCBI)