CAS 1346600-08-5 appears in our catalog under these names: Acetylsulfamonomethoxine (d4 Major), Acetylsulfamonomethoxine–d4. Offered by: TRC, GLPBio. Available pack sizes: 50mg, 5mg.
N-[2,3,5,6-tetradeuterio-4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]acetamide (CAS 1346600-08-5) is a chemical compound with the molecular formula C13H14N4O4S and a molecular weight of 326.37 g/mol. IUPAC name: N-[2,3,5,6-tetradeuterio-4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]acetamide. InChIKey: GYUQXNLLHFAYDF-LNFUJOGGSA-N.
| Molecular formula | C13H14N4O4S |
|---|---|
| Molecular weight | 326.37 g/mol |
| IUPAC name | N-[2,3,5,6-tetradeuterio-4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]acetamide |
| InChIKey | GYUQXNLLHFAYDF-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)C)[2H])[2H])S(=O)(=O)NC2=CC(=NC=N2)OC)[2H] |
Computed by PubChem (NCBI)