CAS 1346600-15-4 appears in our catalog under these names: AM-694-d4, >95% (HPLC), AM–694–d4. Offered by: TRC, GLPBio. Available pack sizes: 10mg, 1mg.
[1-(5-fluoropentyl)indol-3-yl]-(2,3,4,5-tetradeuterio-6-iodophenyl)methanone (CAS 1346600-15-4) is a chemical compound with the molecular formula C20H19FINO and a molecular weight of 439.3 g/mol. IUPAC name: [1-(5-fluoropentyl)indol-3-yl]-(2,3,4,5-tetradeuterio-6-iodophenyl)methanone. InChIKey: LFFIIZFINPPEMC-ZXBLQHTISA-N.
| Molecular formula | C20H19FINO |
|---|---|
| Molecular weight | 439.3 g/mol |
| IUPAC name | [1-(5-fluoropentyl)indol-3-yl]-(2,3,4,5-tetradeuterio-6-iodophenyl)methanone |
| InChIKey | LFFIIZFINPPEMC-ZXBLQHTISA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)C2=CN(C3=CC=CC=C32)CCCCCF)I)[2H])[2H] |
Computed by PubChem (NCBI)