Products 1346600-20-1
CAS 1346600-20-1 is the registry number for rac Desisopropyl Tolterodine-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-phenylpropyl]-4-methylphenol (CAS 1346600-20-1) is a chemical compound with the molecular formula C19H25NO and a molecular weight of 290.4 g/mol. IUPAC name: 2-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-phenylpropyl]-4-methylphenol. InChIKey: CPLYUIYTJCFQJD-HSNISVEUSA-N.
| Molecular formula | C19H25NO |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 2-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-1-phenylpropyl]-4-methylphenol |
| InChIKey | CPLYUIYTJCFQJD-HSNISVEUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCCC(C1=CC=CC=C1)C2=C(C=CC(=C2)C)O |
Computed by PubChem (NCBI)