CAS 1346600-68-7 appears in our catalog under these names: Cyclophosphamide Impurity 10-d4, N-Dechloroethyl Cyclophosphamide-d4, >95% (HPLC), 3-Dechloroethylifosfamide-d4. Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 1 mg, 10 mg.
N-(2-chloro-1,1,2,2-tetradeuterioethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine (CAS 1346600-68-7) is a chemical compound with the molecular formula C5H12ClN2O2P and a molecular weight of 202.61 g/mol. IUPAC name: N-(2-chloro-1,1,2,2-tetradeuterioethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine. InChIKey: DZKGMGPLDJOVCX-BYUTVXSXSA-N.
| Molecular formula | C5H12ClN2O2P |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | N-(2-chloro-1,1,2,2-tetradeuterioethyl)-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine |
| InChIKey | DZKGMGPLDJOVCX-BYUTVXSXSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])Cl)NP1(=O)NCCCO1 |
Computed by PubChem (NCBI)