Products 1346600-76-7
CAS 1346600-76-7 is the registry number for 2,2'-(2-Hydroxytrimethylene)bis(1-methyl-dihydropyrrole)-d6. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
1,3-bis[1-(trideuteriomethyl)pyrrol-2-yl]propan-2-ol (CAS 1346600-76-7) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 224.33 g/mol. IUPAC name: 1,3-bis[1-(trideuteriomethyl)pyrrol-2-yl]propan-2-ol. InChIKey: DHTGHBBVDGTZGY-WFGJKAKNSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 224.33 g/mol |
| IUPAC name | 1,3-bis[1-(trideuteriomethyl)pyrrol-2-yl]propan-2-ol |
| InChIKey | DHTGHBBVDGTZGY-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N1C=CC=C1CC(CC2=CC=CN2C([2H])([2H])[2H])O |
Computed by PubChem (NCBI)