Products 1346601-02-2
CAS 1346601-02-2 appears in our catalog under these names: Itopride-d6 HCl, Itopride-d6 Hydrochloride, Itopride-d6 (hydrochloride). Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
N-[[4-[2-[bis(trideuteriomethyl)amino]ethoxy]phenyl]methyl]-3,4-dimethoxybenzamide;hydrochloride (CAS 1346601-02-2) is a chemical compound with the molecular formula C20H27ClN2O4 and a molecular weight of 400.9 g/mol. IUPAC name: N-[[4-[2-[bis(trideuteriomethyl)amino]ethoxy]phenyl]methyl]-3,4-dimethoxybenzamide;hydrochloride. InChIKey: ZTOUXLLIPWWHSR-TXHXQZCNSA-N.
| Molecular formula | C20H27ClN2O4 |
|---|---|
| Molecular weight | 400.9 g/mol |
| IUPAC name | N-[[4-[2-[bis(trideuteriomethyl)amino]ethoxy]phenyl]methyl]-3,4-dimethoxybenzamide;hydrochloride |
| InChIKey | ZTOUXLLIPWWHSR-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCOC1=CC=C(C=C1)CNC(=O)C2=CC(=C(C=C2)OC)OC)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)