CAS 1346601-72-6 appears in our catalog under these names: 2-(2-Fluoro-3',4'-dimethoxy-[1,1'-biphenyl]-4-yl)propanoic acid, 98%, 3’,4’-Dimethoxy flurbiprofen. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg.
2-[4-(3,4-dimethoxyphenyl)-3-fluorophenyl]propanoic acid (CAS 1346601-72-6) is a chemical compound with the molecular formula C17H17FO4 and a molecular weight of 304.31 g/mol. IUPAC name: 2-[4-(3,4-dimethoxyphenyl)-3-fluorophenyl]propanoic acid. InChIKey: LOLOPVAXJOQCPF-UHFFFAOYSA-N.
| Molecular formula | C17H17FO4 |
|---|---|
| Molecular weight | 304.31 g/mol |
| IUPAC name | 2-[4-(3,4-dimethoxyphenyl)-3-fluorophenyl]propanoic acid |
| InChIKey | LOLOPVAXJOQCPF-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)C2=CC(=C(C=C2)OC)OC)F)C(=O)O |
Computed by PubChem (NCBI)