CAS 1346601-82-8 appears in our catalog under these names: Deferiprone-d3, Deferiprone-d3, >95% (HPLC), Deferiprone–d3, Deferiprone-d3, 99.46%. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 1mg.
3-hydroxy-2-methyl-1-(trideuteriomethyl)pyridin-4-one (CAS 1346601-82-8) is a chemical compound with the molecular formula C7H9NO2 and a molecular weight of 142.17 g/mol. IUPAC name: 3-hydroxy-2-methyl-1-(trideuteriomethyl)pyridin-4-one. InChIKey: TZXKOCQBRNJULO-BMSJAHLVSA-N.
| Molecular formula | C7H9NO2 |
|---|---|
| Molecular weight | 142.17 g/mol |
| IUPAC name | 3-hydroxy-2-methyl-1-(trideuteriomethyl)pyridin-4-one |
| InChIKey | TZXKOCQBRNJULO-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C=CC(=O)C(=C1C)O |
Computed by PubChem (NCBI)