Products 1346602-05-8
CAS 1346602-05-8 appears in our catalog under these names: 2-(Cyclopropylmethoxy-d4)-acetic Acid, 2-((Cyclopropyl-2,2,3,3-d4)methoxy)acetic acid. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
2-[(2,2,3,3-tetradeuteriocyclopropyl)methoxy]acetic acid (CAS 1346602-05-8) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 134.17 g/mol. IUPAC name: 2-[(2,2,3,3-tetradeuteriocyclopropyl)methoxy]acetic acid. InChIKey: IUWMURBOFGBWBO-LNLMKGTHSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 134.17 g/mol |
| IUPAC name | 2-[(2,2,3,3-tetradeuteriocyclopropyl)methoxy]acetic acid |
| InChIKey | IUWMURBOFGBWBO-LNLMKGTHSA-N |
| SMILES | [2H]C1(C(C1([2H])[2H])COCC(=O)O)[2H] |
Computed by PubChem (NCBI)