CAS 1346602-11-6 appears in our catalog under these names: 4-Nonyl Phenol-13C6 Diethoxylate, 4-Nonyl phenol diethoxylate-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, Get quote.
2-[2-(4-nonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyethoxy]ethanol (CAS 1346602-11-6) is a chemical compound with the molecular formula C19H32O3 and a molecular weight of 314.41 g/mol. IUPAC name: 2-[2-(4-nonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyethoxy]ethanol. InChIKey: BLXVTZPGEOGTGG-AUGRNHFJSA-N.
| Molecular formula | C19H32O3 |
|---|---|
| Molecular weight | 314.41 g/mol |
| IUPAC name | 2-[2-(4-nonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyethoxy]ethanol |
| InChIKey | BLXVTZPGEOGTGG-AUGRNHFJSA-N |
| SMILES | CCCCCCCCC[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)OCCOCCO |
Computed by PubChem (NCBI)