CAS 1346602-98-9 appears in our catalog under these names: Carvedilol Impurity 9, Carvedilol Impurity 14, Carvedilol Impurity 1, Carvedilol Bisalkylpyrocatechol Impurity, >95% (HPLC), Carvedilol bisalkylpyrocatechol impurity. Offered by: Hubei YoungXin, Chemat Brand, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 2,5mg, 5mg.
1-(9H-carbazol-4-yloxy)-3-[2-[2-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]phenoxy]ethylamino]propan-2-ol (CAS 1346602-98-9) is a chemical compound with the molecular formula C40H42N4O6 and a molecular weight of 674.8 g/mol. IUPAC name: 1-(9H-carbazol-4-yloxy)-3-[2-[2-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]phenoxy]ethylamino]propan-2-ol. InChIKey: ROANAWWLGXNTOE-UHFFFAOYSA-N.
| Molecular formula | C40H42N4O6 |
|---|---|
| Molecular weight | 674.8 g/mol |
| IUPAC name | 1-(9H-carbazol-4-yloxy)-3-[2-[2-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]phenoxy]ethylamino]propan-2-ol |
| InChIKey | ROANAWWLGXNTOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC=C3OCC(CNCCOC4=CC=CC=C4OCCNCC(COC5=CC=CC6=C5C7=CC=CC=C7N6)O)O |
Computed by PubChem (NCBI)