Products 1346603-36-8

CAS 1346603-36-8 is the registry number for Decarbonyl Ropinirole Dihydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 25mg, 1mg, 5mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

[2-amino-6-[2-(dipropylamino)ethyl]phenyl]methanol (CAS 1346603-36-8) is a chemical compound with the molecular formula C15H26N2O and a molecular weight of 250.38 g/mol. IUPAC name: [2-amino-6-[2-(dipropylamino)ethyl]phenyl]methanol. InChIKey: ABJQCOIVVOLEKN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26N2O
Molecular weight250.38 g/mol
IUPAC name[2-amino-6-[2-(dipropylamino)ethyl]phenyl]methanol
InChIKeyABJQCOIVVOLEKN-UHFFFAOYSA-N
SMILESCCCN(CCC)CCC1=C(C(=CC=C1)N)CO

Computed by PubChem (NCBI)