Products 1346603-39-1
CAS 1346603-39-1 is the registry number for N4-Methyl Sulfadoxine. Offered by: TRC. Available pack sizes: 500mg.
N-(5,6-dimethoxypyrimidin-4-yl)-4-(methylamino)benzenesulfonamide (CAS 1346603-39-1) is a chemical compound with the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. IUPAC name: N-(5,6-dimethoxypyrimidin-4-yl)-4-(methylamino)benzenesulfonamide. InChIKey: OTCLFKJHHXFXLY-UHFFFAOYSA-N.
| Molecular formula | C13H16N4O4S |
|---|---|
| Molecular weight | 324.36 g/mol |
| IUPAC name | N-(5,6-dimethoxypyrimidin-4-yl)-4-(methylamino)benzenesulfonamide |
| InChIKey | OTCLFKJHHXFXLY-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)S(=O)(=O)NC2=C(C(=NC=N2)OC)OC |
Computed by PubChem (NCBI)