Products 1346603-41-5
CAS 1346603-41-5 appears in our catalog under these names: N-Nitroso Melphalan EP Impurity K-d4, N-Nitrosodiethylamine-d4, >95% (HPLC), N–Nitrosodiethylamine–d4, N-Nitrosodiethylamine-d4. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
N,N-bis(1,1-dideuterioethyl)nitrous amide (CAS 1346603-41-5) is a chemical compound with the molecular formula C4H10N2O and a molecular weight of 106.16 g/mol. IUPAC name: N,N-bis(1,1-dideuterioethyl)nitrous amide. InChIKey: WBNQDOYYEUMPFS-KHORGVISSA-N.
| Molecular formula | C4H10N2O |
|---|---|
| Molecular weight | 106.16 g/mol |
| IUPAC name | N,N-bis(1,1-dideuterioethyl)nitrous amide |
| InChIKey | WBNQDOYYEUMPFS-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C)N(C([2H])([2H])C)N=O |
Computed by PubChem (NCBI)
Synonyms:
N-Nitrosodiethylamine-d4, orb3138395