CAS 1346603-47-1 appears in our catalog under these names: Norflurazon-13C,d3, >95% (HPLC), Norflurazon-13C,d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
4-chloro-5-(trideuterio(113C)methylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one (CAS 1346603-47-1) is a chemical compound with the molecular formula C12H9ClF3N3O and a molecular weight of 307.68 g/mol. IUPAC name: 4-chloro-5-(trideuterio(113C)methylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one. InChIKey: NVGOPFQZYCNLDU-KQORAOOSSA-N.
| Molecular formula | C12H9ClF3N3O |
|---|---|
| Molecular weight | 307.68 g/mol |
| IUPAC name | 4-chloro-5-(trideuterio(113C)methylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one |
| InChIKey | NVGOPFQZYCNLDU-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])NC1=C(C(=O)N(N=C1)C2=CC=CC(=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)