CAS 1346603-73-3 appears in our catalog under these names: 4-(Bromomethyl)-2,2-dimethyl-1,3-dioxolane-d5, >95% (HPLC), 4-(Bromomethyl)-2,2-dimethyl-1,3-dioxolane-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
4-[bromo(dideuterio)methyl]-4,5,5-trideuterio-2,2-dimethyl-1,3-dioxolane (CAS 1346603-73-3) is a chemical compound with the molecular formula C6H11BrO2 and a molecular weight of 200.08 g/mol. IUPAC name: 4-[bromo(dideuterio)methyl]-4,5,5-trideuterio-2,2-dimethyl-1,3-dioxolane. InChIKey: ZOPZKFNSQYCIPP-ZDGANNJSSA-N.
| Molecular formula | C6H11BrO2 |
|---|---|
| Molecular weight | 200.08 g/mol |
| IUPAC name | 4-[bromo(dideuterio)methyl]-4,5,5-trideuterio-2,2-dimethyl-1,3-dioxolane |
| InChIKey | ZOPZKFNSQYCIPP-ZDGANNJSSA-N |
| SMILES | [2H]C1(C(OC(O1)(C)C)([2H])C([2H])([2H])Br)[2H] |
Computed by PubChem (NCBI)