CAS 1346603-92-6 appears in our catalog under these names: Amitrole-13C2,15N2, >95% (HPLC), Amitrole-13C,15N2. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
(3,5-13C2,1,2-15N2)1H-1,2,4-triazol-5-amine (CAS 1346603-92-6) is a chemical compound with the molecular formula C2H4N4 and a molecular weight of 88.053 g/mol. IUPAC name: (3,5-13C2,1,2-15N2)1H-1,2,4-triazol-5-amine. InChIKey: KLSJWNVTNUYHDU-MAUGHLKVSA-N.
| Molecular formula | C2H4N4 |
|---|---|
| Molecular weight | 88.053 g/mol |
| IUPAC name | (3,5-13C2,1,2-15N2)1H-1,2,4-triazol-5-amine |
| InChIKey | KLSJWNVTNUYHDU-MAUGHLKVSA-N |
| SMILES | [13CH]1=[15N][15NH][13C](=N1)N |
Computed by PubChem (NCBI)