Products 1346604-15-6
CAS 1346604-15-6 appears in our catalog under these names: 2-Acetyl-3,4,5,6-tetrahydropyridine-13C2 Hydrochloride (Technical Grade), 2-Acetyl-3,4,5,6-tetrahydropyridine-13C2 hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 2mg, 5mg.
1-(2,3,4,5-tetrahydropyridin-6-yl)(1,2-13C2)ethanone;hydrochloride (CAS 1346604-15-6) is a chemical compound with the molecular formula C7H12ClNO and a molecular weight of 163.61 g/mol. IUPAC name: 1-(2,3,4,5-tetrahydropyridin-6-yl)(1,2-13C2)ethanone;hydrochloride. InChIKey: HBGCMUOZFASYRU-WVEBJHRRSA-N.
| Molecular formula | C7H12ClNO |
|---|---|
| Molecular weight | 163.61 g/mol |
| IUPAC name | 1-(2,3,4,5-tetrahydropyridin-6-yl)(1,2-13C2)ethanone;hydrochloride |
| InChIKey | HBGCMUOZFASYRU-WVEBJHRRSA-N |
| SMILES | [13CH3][13C](=O)C1=NCCCC1.Cl |
Computed by PubChem (NCBI)