Products 1346604-25-8
CAS 1346604-25-8 appears in our catalog under these names: Alarmine–d6, Alarmine-d6, N1,N4-dimethylbenzene-1,4-diamine-d6. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 50mg, 25mg, 100mg, Get quote.
1-N,4-N-bis(trideuteriomethyl)benzene-1,4-diamine (CAS 1346604-25-8) is a chemical compound with the molecular formula C8H12N2 and a molecular weight of 142.23 g/mol. IUPAC name: 1-N,4-N-bis(trideuteriomethyl)benzene-1,4-diamine. InChIKey: PVRZMTHMPKVOBP-WFGJKAKNSA-N.
| Molecular formula | C8H12N2 |
|---|---|
| Molecular weight | 142.23 g/mol |
| IUPAC name | 1-N,4-N-bis(trideuteriomethyl)benzene-1,4-diamine |
| InChIKey | PVRZMTHMPKVOBP-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])NC1=CC=C(C=C1)NC([2H])([2H])[2H] |
Computed by PubChem (NCBI)