CAS 1346604-53-2 is the registry number for 2-(4-(1,1-Dicarboethoxy)benzyl)-2-methyl Malonic Acid-d3. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
2-[[4-(1,1-dicarboxy-2,2,2-trideuterioethyl)phenyl]methyl]-2-methylpropanedioic acid (CAS 1346604-53-2) is a chemical compound with the molecular formula C15H16O8 and a molecular weight of 327.30 g/mol. IUPAC name: 2-[[4-(1,1-dicarboxy-2,2,2-trideuterioethyl)phenyl]methyl]-2-methylpropanedioic acid. InChIKey: ZEKFTEFIUIONLO-BMSJAHLVSA-N.
| Molecular formula | C15H16O8 |
|---|---|
| Molecular weight | 327.30 g/mol |
| IUPAC name | 2-[[4-(1,1-dicarboxy-2,2,2-trideuterioethyl)phenyl]methyl]-2-methylpropanedioic acid |
| InChIKey | ZEKFTEFIUIONLO-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=C(C=C1)CC(C)(C(=O)O)C(=O)O)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)