CAS 1346604-67-8 appears in our catalog under these names: Prothipendyl-d6 Hydrochloride, >95% (HPLC), Prothipendyl-d6 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 2.5 mg, 10 mg, 25 mg.
3-pyrido[3,2-b][1,4]benzothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1346604-67-8) is a chemical compound with the molecular formula C16H20ClN3S and a molecular weight of 327.9 g/mol. IUPAC name: 3-pyrido[3,2-b][1,4]benzothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: CQJSAKJMCVSEGU-TXHXQZCNSA-N.
| Molecular formula | C16H20ClN3S |
|---|---|
| Molecular weight | 327.9 g/mol |
| IUPAC name | 3-pyrido[3,2-b][1,4]benzothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | CQJSAKJMCVSEGU-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCN1C2=CC=CC=C2SC3=C1N=CC=C3)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)