CAS 1346604-71-4 is the registry number for N-Desmethyl Almotriptan-d3. Offered by: TRC. Available pack sizes: 25mg.
2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]-N-(trideuteriomethyl)ethanamine (CAS 1346604-71-4) is a chemical compound with the molecular formula C16H23N3O2S and a molecular weight of 324.5 g/mol. IUPAC name: 2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]-N-(trideuteriomethyl)ethanamine. InChIKey: IREINZNGILEJRP-FIBGUPNXSA-N.
| Molecular formula | C16H23N3O2S |
|---|---|
| Molecular weight | 324.5 g/mol |
| IUPAC name | 2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]-N-(trideuteriomethyl)ethanamine |
| InChIKey | IREINZNGILEJRP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCCC1=CNC2=C1C=C(C=C2)CS(=O)(=O)N3CCCC3 |
Computed by PubChem (NCBI)