CAS 1346604-81-6 appears in our catalog under these names: 4-(4-(Dimethylamino)naphthalen-1-yl)-1,2,4-triazolidine-3,5-dione, 98%, 4-(4-(Dimethylamino)naphthyl)-1,2,4-triazolidine-3,5-dione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5mg, 25mg.
4-[4-(dimethylamino)naphthalen-1-yl]-1,2,4-triazolidine-3,5-dione (CAS 1346604-81-6) is a chemical compound with the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. IUPAC name: 4-[4-(dimethylamino)naphthalen-1-yl]-1,2,4-triazolidine-3,5-dione. InChIKey: TUTLQTWYOOLPBL-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O2 |
|---|---|
| Molecular weight | 270.29 g/mol |
| IUPAC name | 4-[4-(dimethylamino)naphthalen-1-yl]-1,2,4-triazolidine-3,5-dione |
| InChIKey | TUTLQTWYOOLPBL-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C2=CC=CC=C21)N3C(=O)NNC3=O |
Computed by PubChem (NCBI)