CAS 1346604-85-0 is the registry number for N,N-Dimethyl-1H-indene-2-ethanamine-d6 hydrochloride. Offered by: Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 25mg.
2-(1H-inden-2-yl)-N,N-bis(trideuteriomethyl)ethanamine;hydrochloride (CAS 1346604-85-0) is a chemical compound with the molecular formula C13H18ClN and a molecular weight of 229.78 g/mol. IUPAC name: 2-(1H-inden-2-yl)-N,N-bis(trideuteriomethyl)ethanamine;hydrochloride. InChIKey: JUASECOLMLHBSN-TXHXQZCNSA-N.
| Molecular formula | C13H18ClN |
|---|---|
| Molecular weight | 229.78 g/mol |
| IUPAC name | 2-(1H-inden-2-yl)-N,N-bis(trideuteriomethyl)ethanamine;hydrochloride |
| InChIKey | JUASECOLMLHBSN-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC1=CC2=CC=CC=C2C1)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)