Products 1346605-11-5
CAS 1346605-11-5 is the registry number for 2-Amino-4,6-dichloropyrimidine-13C2. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
4,6-dichloro(4,6-13C2)pyrimidin-2-amine (CAS 1346605-11-5) is a chemical compound with the molecular formula C4H3Cl2N3 and a molecular weight of 165.98 g/mol. IUPAC name: 4,6-dichloro(4,6-13C2)pyrimidin-2-amine. InChIKey: JPZOAVGMSDSWSW-SUEIGJEOSA-N.
| Molecular formula | C4H3Cl2N3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | 4,6-dichloro(4,6-13C2)pyrimidin-2-amine |
| InChIKey | JPZOAVGMSDSWSW-SUEIGJEOSA-N |
| SMILES | C1=[13C](N=C(N=[13C]1Cl)N)Cl |
Computed by PubChem (NCBI)