Products 1346606-39-0
CAS 1346606-39-0 appears in our catalog under these names: Azoxystrobin-d4, >95% (HPLC), Azoxystrobin D4, Azoxystrobin–d4, Azoxystrobin-d4, AZOXYSTROBIN-(CYANOPHENOXY-D4). Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 10mg, 1mg, 25mg, 5mg, 50mg, 1 mg, 25 mg, 10 mg.
Methyl (E)-2-[2-[6-(2-cyano-3,4,5,6-tetradeuteriophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate (CAS 1346606-39-0) is a chemical compound with the molecular formula C22H17N3O5 and a molecular weight of 407.4 g/mol. IUPAC name: methyl (E)-2-[2-[6-(2-cyano-3,4,5,6-tetradeuteriophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate. InChIKey: WFDXOXNFNRHQEC-IRBJAXQRSA-N.
| Molecular formula | C22H17N3O5 |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | methyl (E)-2-[2-[6-(2-cyano-3,4,5,6-tetradeuteriophenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate |
| InChIKey | WFDXOXNFNRHQEC-IRBJAXQRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C#N)OC2=CC(=NC=N2)OC3=CC=CC=C3/C(=C\OC)/C(=O)OC)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Azoxystrobin-d4, Azoxystrobin D4