Products 1346606-68-5

CAS 1346606-68-5 is the registry number for (E)-5-(3-Aminophenyl)-2-penten-4-ynoic Acid Ethyl Ester Trifluoroacetic Acid Salt. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

Ethyl (E)-5-(3-aminophenyl)pent-2-en-4-ynoate;2,2,2-trifluoroacetic acid (CAS 1346606-68-5) is a chemical compound with the molecular formula C15H14F3NO4 and a molecular weight of 329.27 g/mol. IUPAC name: ethyl (E)-5-(3-aminophenyl)pent-2-en-4-ynoate;2,2,2-trifluoroacetic acid. InChIKey: ZTGSSAPOWVFJQB-JOKMOOFLSA-N.

Identity
Molecular formulaC15H14F3NO4
Molecular weight329.27 g/mol
IUPAC nameethyl (E)-5-(3-aminophenyl)pent-2-en-4-ynoate;2,2,2-trifluoroacetic acid
InChIKeyZTGSSAPOWVFJQB-JOKMOOFLSA-N
SMILESCCOC(=O)/C=C/C#CC1=CC(=CC=C1)N.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)