CAS 1346606-68-5 is the registry number for (E)-5-(3-Aminophenyl)-2-penten-4-ynoic Acid Ethyl Ester Trifluoroacetic Acid Salt. Offered by: TRC. Available pack sizes: 250mg, 25mg.
Ethyl (E)-5-(3-aminophenyl)pent-2-en-4-ynoate;2,2,2-trifluoroacetic acid (CAS 1346606-68-5) is a chemical compound with the molecular formula C15H14F3NO4 and a molecular weight of 329.27 g/mol. IUPAC name: ethyl (E)-5-(3-aminophenyl)pent-2-en-4-ynoate;2,2,2-trifluoroacetic acid. InChIKey: ZTGSSAPOWVFJQB-JOKMOOFLSA-N.
| Molecular formula | C15H14F3NO4 |
|---|---|
| Molecular weight | 329.27 g/mol |
| IUPAC name | ethyl (E)-5-(3-aminophenyl)pent-2-en-4-ynoate;2,2,2-trifluoroacetic acid |
| InChIKey | ZTGSSAPOWVFJQB-JOKMOOFLSA-N |
| SMILES | CCOC(=O)/C=C/C#CC1=CC(=CC=C1)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)