Products 1346616-96-3
CAS 1346616-96-3 appears in our catalog under these names: (R)-1-Aminoindane-d3 Hydrochloride, (R)–1–Aminoindane–d3 Hydrochloride. Offered by: TRC, GLPBio. Available pack sizes: 50mg, 5mg.
(1R)-1,2,2-trideuterio-3H-inden-1-amine;hydrochloride (CAS 1346616-96-3) is a chemical compound with the molecular formula C9H12ClN and a molecular weight of 172.67 g/mol. IUPAC name: (1R)-1,2,2-trideuterio-3H-inden-1-amine;hydrochloride. InChIKey: RHAAGWRBIVCBSY-GYQYCVPMSA-N.
| Molecular formula | C9H12ClN |
|---|---|
| Molecular weight | 172.67 g/mol |
| IUPAC name | (1R)-1,2,2-trideuterio-3H-inden-1-amine;hydrochloride |
| InChIKey | RHAAGWRBIVCBSY-GYQYCVPMSA-N |
| SMILES | [2H][C@@]1(C2=CC=CC=C2CC1([2H])[2H])N.Cl |
Computed by PubChem (NCBI)