Products 1346617-05-7
CAS 1346617-05-7 is the registry number for L–2–Aminobutyric Acid–d5 Methyl Ester Hydrochloride. Offered by: GLPBio. Available pack sizes: 10mg.
Methyl (2S)-2-amino-3,3,4,4,4-pentadeuteriobutanoate;hydrochloride (CAS 1346617-05-7) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 158.64 g/mol. IUPAC name: methyl (2S)-2-amino-3,3,4,4,4-pentadeuteriobutanoate;hydrochloride. InChIKey: AHAQQEGUPULIOZ-DJSUJWQHSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 158.64 g/mol |
| IUPAC name | methyl (2S)-2-amino-3,3,4,4,4-pentadeuteriobutanoate;hydrochloride |
| InChIKey | AHAQQEGUPULIOZ-DJSUJWQHSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)