CAS 1346617-43-3 is the registry number for D-(-)-Pantolactone-d6. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one (CAS 1346617-43-3) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 136.18 g/mol. IUPAC name: (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one. InChIKey: SERHXTVXHNVDKA-JJCAPIKSSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 136.18 g/mol |
| IUPAC name | (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one |
| InChIKey | SERHXTVXHNVDKA-JJCAPIKSSA-N |
| SMILES | [2H]C([2H])([2H])C1(COC(=O)[C@@H]1O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)