CAS 1346665-27-7 is the registry number for 2-Ethyl-5-(trifluoromethyl)pyrazole-3-boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
[1-ethyl-3-(trifluoromethyl)pyrazol-5-yl]boronic acid (CAS 1346665-27-7) is a chemical compound with the molecular formula C6H8BF3N2O2 and a molecular weight of 207.95 g/mol. IUPAC name: [1-ethyl-3-(trifluoromethyl)pyrazol-5-yl]boronic acid. InChIKey: ZTZOXIFXHVHNBB-UHFFFAOYSA-N.
| Molecular formula | C6H8BF3N2O2 |
|---|---|
| Molecular weight | 207.95 g/mol |
| IUPAC name | [1-ethyl-3-(trifluoromethyl)pyrazol-5-yl]boronic acid |
| InChIKey | ZTZOXIFXHVHNBB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NN1CC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)