Products 1346673-35-5
CAS 1346673-35-5 is the registry number for 5-Cyclopropyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-amine, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
5-cyclopropyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-amine (CAS 1346673-35-5) is a chemical compound with the molecular formula C9H14N4 and a molecular weight of 178.23 g/mol. IUPAC name: 5-cyclopropyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-amine. InChIKey: WYNSZGAWVOMWQS-UHFFFAOYSA-N.
| Molecular formula | C9H14N4 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 5-cyclopropyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-amine |
| InChIKey | WYNSZGAWVOMWQS-UHFFFAOYSA-N |
| SMILES | C1CC1N2CCN3C(=CC(=N3)N)C2 |
Computed by PubChem (NCBI)