Products 1346747-15-6
CAS 1346747-15-6 is the registry number for Nefopam-d3. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
1-phenyl-5-(trideuteriomethyl)-1,3,4,6-tetrahydro-2,5-benzoxazocine (CAS 1346747-15-6) is a chemical compound with the molecular formula C17H19NO and a molecular weight of 256.36 g/mol. IUPAC name: 1-phenyl-5-(trideuteriomethyl)-1,3,4,6-tetrahydro-2,5-benzoxazocine. InChIKey: RGPDEAGGEXEMMM-FIBGUPNXSA-N.
| Molecular formula | C17H19NO |
|---|---|
| Molecular weight | 256.36 g/mol |
| IUPAC name | 1-phenyl-5-(trideuteriomethyl)-1,3,4,6-tetrahydro-2,5-benzoxazocine |
| InChIKey | RGPDEAGGEXEMMM-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCOC(C2=CC=CC=C2C1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)