Products 1346747-57-6
CAS 1346747-57-6 is the registry number for L-2-Aminobutanoate Methyl Ester-d5. Offered by: TRC. Available pack sizes: 250mg.
Methyl (2S)-2-amino-3,3,4,4,4-pentadeuteriobutanoate (CAS 1346747-57-6) is a chemical compound with the molecular formula C5H11NO2 and a molecular weight of 122.18 g/mol. IUPAC name: methyl (2S)-2-amino-3,3,4,4,4-pentadeuteriobutanoate. InChIKey: ZZWPOYPWQTUZDY-DOTJASJKSA-N.
| Molecular formula | C5H11NO2 |
|---|---|
| Molecular weight | 122.18 g/mol |
| IUPAC name | methyl (2S)-2-amino-3,3,4,4,4-pentadeuteriobutanoate |
| InChIKey | ZZWPOYPWQTUZDY-DOTJASJKSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[C@@H](C(=O)OC)N |
Computed by PubChem (NCBI)
Synonyms:
L-2-Aminobutanoate Methyl Ester-d5