CAS 1346758-67-5 is the registry number for (1S,4S)-1,7,7-Trimethyl-2,5-diphenylbicyclo[2.2.1]hepta-2,5-diene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
(1S,4S)-1,7,7-trimethyl-2,5-diphenylbicyclo[2.2.1]hepta-2,5-diene (CAS 1346758-67-5) is a chemical compound with the molecular formula C22H22 and a molecular weight of 286.4 g/mol. IUPAC name: (1S,4S)-1,7,7-trimethyl-2,5-diphenylbicyclo[2.2.1]hepta-2,5-diene. InChIKey: SLXKTEUTAJBJQV-IFMALSPDSA-N.
| Molecular formula | C22H22 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (1S,4S)-1,7,7-trimethyl-2,5-diphenylbicyclo[2.2.1]hepta-2,5-diene |
| InChIKey | SLXKTEUTAJBJQV-IFMALSPDSA-N |
| SMILES | C[C@]12C=C([C@H](C1(C)C)C=C2C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)