CAS 1346808-54-5 is the registry number for 2-(N-Cyclopentylamino)pyridine-4-boronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 1346808-54-5) is a chemical compound with the molecular formula C16H25BN2O2 and a molecular weight of 288.2 g/mol. IUPAC name: N-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: QCTTWAKKRFCHKJ-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O2 |
|---|---|
| Molecular weight | 288.2 g/mol |
| IUPAC name | N-cyclopentyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | QCTTWAKKRFCHKJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)NC3CCCC3 |
Computed by PubChem (NCBI)