CAS 1346818-25-4 is the registry number for Crizotinib Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-[(1R)-1-[5-fluoro-2-(triazol-2-yl)phenyl]ethoxy]pyridin-2-amine (CAS 1346818-25-4) is a chemical compound with the molecular formula C15H13BrFN5O and a molecular weight of 378.20 g/mol. IUPAC name: 5-bromo-3-[(1R)-1-[5-fluoro-2-(triazol-2-yl)phenyl]ethoxy]pyridin-2-amine. InChIKey: ZGHJARSCSDRNQW-SECBINFHSA-N.
| Molecular formula | C15H13BrFN5O |
|---|---|
| Molecular weight | 378.20 g/mol |
| IUPAC name | 5-bromo-3-[(1R)-1-[5-fluoro-2-(triazol-2-yl)phenyl]ethoxy]pyridin-2-amine |
| InChIKey | ZGHJARSCSDRNQW-SECBINFHSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1)F)N2N=CC=N2)OC3=C(N=CC(=C3)Br)N |
Computed by PubChem (NCBI)