Products 13470-01-4

CAS 13470-01-4 is the registry number for Strontium Iodate, 99%. Offered by: Chemat Brand. Available pack sizes: on request.

Strontium diiodate (CAS 13470-01-4) is a chemical compound with the molecular formula I2O6Sr and a molecular weight of 437.43 g/mol. IUPAC name: strontium diiodate. InChIKey: JKGZNVNIOGGUKH-UHFFFAOYSA-L.

Identity
Molecular formulaI2O6Sr
Molecular weight437.43 g/mol
IUPAC namestrontium diiodate
InChIKeyJKGZNVNIOGGUKH-UHFFFAOYSA-L
SMILES[O-]I(=O)=O.[O-]I(=O)=O.[Sr+2]

Computed by PubChem (NCBI)