CAS 13470-01-4 is the registry number for Strontium Iodate, 99%. Offered by: Chemat Brand. Available pack sizes: on request.
Strontium diiodate (CAS 13470-01-4) is a chemical compound with the molecular formula I2O6Sr and a molecular weight of 437.43 g/mol. IUPAC name: strontium diiodate. InChIKey: JKGZNVNIOGGUKH-UHFFFAOYSA-L.
| Molecular formula | I2O6Sr |
|---|---|
| Molecular weight | 437.43 g/mol |
| IUPAC name | strontium diiodate |
| InChIKey | JKGZNVNIOGGUKH-UHFFFAOYSA-L |
| SMILES | [O-]I(=O)=O.[O-]I(=O)=O.[Sr+2] |
Computed by PubChem (NCBI)