CAS 1347118-41-5 is the registry number for 9-(2'-O-Acetyl-5'-O-benzoyl-3'-deoxy-beta-D-ribofuranosyl)-6-chloropurine. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2S,4R,5R)-4-acetyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]methyl benzoate (CAS 1347118-41-5) is a chemical compound with the molecular formula C19H17ClN4O5 and a molecular weight of 416.8 g/mol. IUPAC name: [(2S,4R,5R)-4-acetyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]methyl benzoate. InChIKey: HCRYZQKBFPVPFX-PMUMKWKESA-N.
| Molecular formula | C19H17ClN4O5 |
|---|---|
| Molecular weight | 416.8 g/mol |
| IUPAC name | [(2S,4R,5R)-4-acetyloxy-5-(6-chloropurin-9-yl)oxolan-2-yl]methyl benzoate |
| InChIKey | HCRYZQKBFPVPFX-PMUMKWKESA-N |
| SMILES | CC(=O)O[C@@H]1C[C@H](O[C@H]1N2C=NC3=C2N=CN=C3Cl)COC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)