CAS 134716-82-8 is the registry number for 4,6-Dichloro-5-nitropyrimidin-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
4,6-dichloro-5-nitropyrimidin-2-amine (CAS 134716-82-8) is a chemical compound with the molecular formula C4H2Cl2N4O2 and a molecular weight of 208.99 g/mol. IUPAC name: 4,6-dichloro-5-nitropyrimidin-2-amine. InChIKey: KIOZJDBYVRMAGM-UHFFFAOYSA-N.
| Molecular formula | C4H2Cl2N4O2 |
|---|---|
| Molecular weight | 208.99 g/mol |
| IUPAC name | 4,6-dichloro-5-nitropyrimidin-2-amine |
| InChIKey | KIOZJDBYVRMAGM-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(N=C1Cl)N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)