CAS 13474-51-6 is the registry number for Copper(II) 2-hydroxyacetate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(2-hydroxyacetate) (CAS 13474-51-6) is a chemical compound with the molecular formula C4H6CuO6 and a molecular weight of 213.63 g/mol. IUPAC name: copper bis(2-hydroxyacetate). InChIKey: HXXRDHUDBAILGK-UHFFFAOYSA-L.
| Molecular formula | C4H6CuO6 |
|---|---|
| Molecular weight | 213.63 g/mol |
| IUPAC name | copper bis(2-hydroxyacetate) |
| InChIKey | HXXRDHUDBAILGK-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])O.C(C(=O)[O-])O.[Cu+2] |
Computed by PubChem (NCBI)