CAS 13475-86-0 appears in our catalog under these names: (2S,3R,4R,5R,6R)–3–acetamido–6–methyltetrahydro–2H–pyran–2,4,5–triyl triacetate, 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-β-D-quinovose. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 50mg, 500mg.
[(2R,3R,4R,5R,6S)-5-acetamido-4,6-diacetyloxy-2-methyloxan-3-yl] acetate (CAS 13475-86-0) is a chemical compound with the molecular formula C14H21NO8 and a molecular weight of 331.32 g/mol. IUPAC name: [(2R,3R,4R,5R,6S)-5-acetamido-4,6-diacetyloxy-2-methyloxan-3-yl] acetate. InChIKey: GRCSYICXTXYMJJ-BZSUZSTPSA-N.
| Molecular formula | C14H21NO8 |
|---|---|
| Molecular weight | 331.32 g/mol |
| IUPAC name | [(2R,3R,4R,5R,6S)-5-acetamido-4,6-diacetyloxy-2-methyloxan-3-yl] acetate |
| InChIKey | GRCSYICXTXYMJJ-BZSUZSTPSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=O)C)NC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)